C25H32N2O5 — CID 110072765
2-[(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid (PubChem CID 110072765) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 110072765 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-[(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1ccc2c(c1)Cc1cccc(c1)CN(C(C)C)CCOCCO2)C(=O)O |
| InChI | InChI=1S/C25H32N2O5/c1-17(2)27-9-10-31-11-12-32-23-8-7-21(24(28)26-18(3)25(29)30)15-22(23)14-19-5-4-6-20(13-19)16-27/h4-8,13,15,17-18H,9-12,14,16H2,1-3H3,(H,26,28)(H,29,30) |
| InChIKey | SCFWGTBPOJEFEP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |