C29H38N2O4 — CID 110072683
(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone (PubChem CID 110072683) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone.
| Compound Name | (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone |
|---|---|
| PubChem CID | 110072683 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone |
| SMILES | CC(C)N1CCOCCOc2ccc(C(=O)N3C4CCC3CC(O)C4)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C29H38N2O4/c1-20(2)30-10-11-34-12-13-35-28-9-6-23(16-24(28)15-21-4-3-5-22(14-21)19-30)29(33)31-25-7-8-26(31)18-27(32)17-25/h3-6,9,14,16,20,25-27,32H,7-8,10-13,15,17-19H2,1-2H3 |
| InChIKey | IUTQMFFKZSSPKC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |