C28H36N2O3 — CID 110072983
(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-(15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone (PubChem CID 110072983) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-(15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone.
| Compound Name | (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-(15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone |
|---|---|
| PubChem CID | 110072983 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-(15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone |
| SMILES | CN1CCCCCOc2ccc(C(=O)N3C4CCC3CC(O)C4)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C28H36N2O3/c1-29-12-3-2-4-13-33-27-11-8-22(16-23(27)15-20-6-5-7-21(14-20)19-29)28(32)30-24-9-10-25(30)18-26(31)17-24/h5-8,11,14,16,24-26,31H,2-4,9-10,12-13,15,17-19H2,1H3 |
| InChIKey | RSSYOBYXWFXRKL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |