C29H33FN2O2 — CID 110072938
N-[2-(4-fluorophenyl)ethyl]-15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072938) has the molecular formula C29H33FN2O2 and a molecular weight of 460.59 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072938 |
| Molecular Formula | C29H33FN2O2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | CN1CCCCCOc2ccc(C(=O)NCCc3ccc(F)cc3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C29H33FN2O2/c1-32-16-3-2-4-17-34-28-13-10-25(20-26(28)19-23-6-5-7-24(18-23)21-32)29(33)31-15-14-22-8-11-27(30)12-9-22/h5-13,18,20H,2-4,14-17,19,21H2,1H3,(H,31,33) |
| InChIKey | WTAAQFHBQXVOPU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |