C34H41N3O2 — CID 110072942
15-methyl-N-[2-(1,2,6-trimethylindol-3-yl)ethyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072942) has the molecular formula C34H41N3O2 and a molecular weight of 523.72 g/mol. Its IUPAC name is 15-methyl-N-[2-(1,2,6-trimethylindol-3-yl)ethyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | 15-methyl-N-[2-(1,2,6-trimethylindol-3-yl)ethyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072942 |
| Molecular Formula | C34H41N3O2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | 15-methyl-N-[2-(1,2,6-trimethylindol-3-yl)ethyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | Cc1ccc2c(CCNC(=O)c3ccc4c(c3)Cc3cccc(c3)CN(C)CCCCCO4)c(C)n(C)c2c1 |
| InChI | InChI=1S/C34H41N3O2/c1-24-11-13-31-30(25(2)37(4)32(31)19-24)15-16-35-34(38)28-12-14-33-29(22-28)21-26-9-8-10-27(20-26)23-36(3)17-6-5-7-18-39-33/h8-14,19-20,22H,5-7,15-18,21,23H2,1-4H3,(H,35,38) |
| InChIKey | JEURSMAULRBVFQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|