C33H41FN2O2 — CID 155993743
N-[2-(4-fluorophenyl)-2-methylpropyl]-15-propyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 155993743) has the molecular formula C33H41FN2O2 and a molecular weight of 516.70 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-methylpropyl]-15-propyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-methylpropyl]-15-propyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 155993743 |
| Molecular Formula | C33H41FN2O2 |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-methylpropyl]-15-propyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | CCCN1CCCCCOc2ccc(C(=O)NCC(C)(C)c3ccc(F)cc3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C33H41FN2O2/c1-4-17-36-18-6-5-7-19-38-31-16-11-27(22-28(31)21-25-9-8-10-26(20-25)23-36)32(37)35-24-33(2,3)29-12-14-30(34)15-13-29/h8-16,20,22H,4-7,17-19,21,23-24H2,1-3H3,(H,35,37) |
| InChIKey | ZWAPZTIXJAXMKR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |