C29H40N2O3 — CID 110070800
[15-(3,3-dimethylbutyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]-(3-hydroxyazetidin-1-yl)methanone (PubChem CID 110070800) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is [15-(3,3-dimethylbutyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]-(3-hydroxyazetidin-1-yl)methanone.
| Compound Name | [15-(3,3-dimethylbutyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]-(3-hydroxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 110070800 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | [15-(3,3-dimethylbutyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]-(3-hydroxyazetidin-1-yl)methanone |
| SMILES | CC(C)(C)CCN1CCCCCOc2ccc(C(=O)N3CC(O)C3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C29H40N2O3/c1-29(2,3)12-14-30-13-5-4-6-15-34-27-11-10-24(28(33)31-20-26(32)21-31)18-25(27)17-22-8-7-9-23(16-22)19-30/h7-11,16,18,26,32H,4-6,12-15,17,19-21H2,1-3H3 |
| InChIKey | LDHIFZLKMRYTPW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |