C28H30ClNO3 — CID 110068404
3-(4-chlorophenyl)-1-(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)propan-1-one (PubChem CID 110068404) has the molecular formula C28H30ClNO3 and a molecular weight of 464.01 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)propan-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)propan-1-one |
|---|---|
| PubChem CID | 110068404 |
| Molecular Formula | C28H30ClNO3 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)propan-1-one |
| SMILES | Cc1ccc2c(c1)Cc1cccc(c1)CN(C(=O)CCc1ccc(Cl)cc1)CCOCCO2 |
| InChI | InChI=1S/C28H30ClNO3/c1-21-5-11-27-25(17-21)19-23-3-2-4-24(18-23)20-30(13-14-32-15-16-33-27)28(31)12-8-22-6-9-26(29)10-7-22/h2-7,9-11,17-18H,8,12-16,19-20H2,1H3 |
| InChIKey | BOAASWXCDMPGGG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |