C29H30N2O3 — CID 110068415
(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-(1-methylindol-3-yl)methanone (PubChem CID 110068415) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is (5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-(1-methylindol-3-yl)methanone.
| Compound Name | (5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-(1-methylindol-3-yl)methanone |
|---|---|
| PubChem CID | 110068415 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-(1-methylindol-3-yl)methanone |
| SMILES | Cc1ccc2c(c1)Cc1cccc(c1)CN(C(=O)c1cn(C)c3ccccc13)CCOCCO2 |
| InChI | InChI=1S/C29H30N2O3/c1-21-10-11-28-24(16-21)18-22-6-5-7-23(17-22)19-31(12-13-33-14-15-34-28)29(32)26-20-30(2)27-9-4-3-8-25(26)27/h3-11,16-17,20H,12-15,18-19H2,1-2H3 |
| InChIKey | QPCYZFKLGMEQQB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |