C29H33NO4 — CID 110074967
(3-methoxyphenyl)-(5-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)methanone (PubChem CID 110074967) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is (3-methoxyphenyl)-(5-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)methanone.
| Compound Name | (3-methoxyphenyl)-(5-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)methanone |
|---|---|
| PubChem CID | 110074967 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (3-methoxyphenyl)-(5-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)methanone |
| SMILES | COc1cccc(C(=O)N2CCOCCOc3ccc(C(C)C)cc3Cc3cccc(c3)C2)c1 |
| InChI | InChI=1S/C29H33NO4/c1-21(2)24-10-11-28-26(18-24)17-22-6-4-7-23(16-22)20-30(12-13-33-14-15-34-28)29(31)25-8-5-9-27(19-25)32-3/h4-11,16,18-19,21H,12-15,17,20H2,1-3H3 |
| InChIKey | RPYXQRVXTOWMIY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |