C30H30N2O5 — CID 133073668
9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3,5,7,17,19-hexaen-15-yl-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone (PubChem CID 133073668) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3,5,7,17,19-hexaen-15-yl-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone.
| Compound Name | 9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3,5,7,17,19-hexaen-15-yl-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 133073668 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3,5,7,17,19-hexaen-15-yl-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
| SMILES | COc1ccccc1-c1noc(C)c1C(=O)N1CCOCCOc2ccccc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C30H30N2O5/c1-21-28(29(31-37-21)25-11-4-6-13-27(25)34-2)30(33)32-14-15-35-16-17-36-26-12-5-3-10-24(26)19-22-8-7-9-23(18-22)20-32/h3-13,18H,14-17,19-20H2,1-2H3 |
| InChIKey | UWPCHIJJVJLRMD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |