C12H10NO4- — CID 7446909
3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 7446909) has the molecular formula C12H10NO4- and a molecular weight of 232.22 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | 3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 7446909 |
| Molecular Formula | C12H10NO4- |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | COc1ccccc1-c1noc(C)c1C(=O)[O-] |
| InChI | InChI=1S/C12H11NO4/c1-7-10(12(14)15)11(13-17-7)8-5-3-4-6-9(8)16-2/h3-6H,1-2H3,(H,14,15)/p-1 |
| InChIKey | KOQSJBSGCNLIJY-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 75.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |