C13H12ClNO4 — CID 82371450
3-(2,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (PubChem CID 82371450) has the molecular formula C13H12ClNO4 and a molecular weight of 281.70 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride.
| Compound Name | 3-(2,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 82371450 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride |
| SMILES | COc1ccc(-c2noc(C)c2C(=O)Cl)c(OC)c1 |
| InChI | InChI=1S/C13H12ClNO4/c1-7-11(13(14)16)12(15-19-7)9-5-4-8(17-2)6-10(9)18-3/h4-6H,1-3H3 |
| InChIKey | AKRLFSWVUWBIRJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|