C12H11NO5 — CID 82296819
3-(2,4-dimethoxyphenyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 82296819) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82296819 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2nocc2C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C12H11NO5/c1-16-7-3-4-8(10(5-7)17-2)11-9(12(14)15)6-18-13-11/h3-6H,1-2H3,(H,14,15) |
| InChIKey | QOHVTIOOHSEQFO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |