About methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate
methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate (PubChem CID 870182) has the molecular formula C13H13NO5
and a molecular weight of 263.25 g/mol. Its IUPAC name is methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate.
Analyze methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate (CID 870182) is methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate is COC(=O)c1conc1-c1cc(OC)ccc1OC.
What is the InChIKey of methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate?
The InChIKey is ZZTJJHKOZGZBMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c1-16-8-4-5-11(17-2)9(6-8)12-10(7-19-14-12)13(15)18-3/h4-7H,1-3H3.
What are the key properties of methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate?
methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate has a molecular weight of 263.25 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,5-dimethoxyphenyl)-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 870182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).