C10H8N2O3 — CID 767299
methyl 3-pyridin-2-yl-1,2-oxazole-4-carboxylate (PubChem CID 767299) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is methyl 3-pyridin-2-yl-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-pyridin-2-yl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 767299 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | methyl 3-pyridin-2-yl-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1conc1-c1ccccn1 |
| InChI | InChI=1S/C10H8N2O3/c1-14-10(13)7-6-15-12-9(7)8-4-2-3-5-11-8/h2-6H,1H3 |
| InChIKey | BWGCOARLHONPOM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |