C17H14N4O5 — CID 148741054
N-[4-amino-1-(furan-3-yl)-3,4-dioxobutan-2-yl]-3-pyridin-2-yl-1,2-oxazole-4-carboxamide (PubChem CID 148741054) has the molecular formula C17H14N4O5 and a molecular weight of 354.32 g/mol. Its IUPAC name is N-[4-amino-1-(furan-3-yl)-3,4-dioxobutan-2-yl]-3-pyridin-2-yl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[4-amino-1-(furan-3-yl)-3,4-dioxobutan-2-yl]-3-pyridin-2-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 148741054 |
| Molecular Formula | C17H14N4O5 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-[4-amino-1-(furan-3-yl)-3,4-dioxobutan-2-yl]-3-pyridin-2-yl-1,2-oxazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccoc1)NC(=O)c1conc1-c1ccccn1 |
| InChI | InChI=1S/C17H14N4O5/c18-16(23)15(22)13(7-10-4-6-25-8-10)20-17(24)11-9-26-21-14(11)12-3-1-2-5-19-12/h1-6,8-9,13H,7H2,(H2,18,23)(H,20,24) |
| InChIKey | OCVOWJQCIFLHHZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 141.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|