C19H16N4O4 — CID 153385951
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-pyridin-3-yl-1,2-oxazole-4-carboxamide (PubChem CID 153385951) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-pyridin-3-yl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 153385951 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-pyridin-3-yl-1,2-oxazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1conc1-c1cccnc1 |
| InChI | InChI=1S/C19H16N4O4/c20-18(25)17(24)15(9-12-5-2-1-3-6-12)22-19(26)14-11-27-23-16(14)13-7-4-8-21-10-13/h1-8,10-11,15H,9H2,(H2,20,25)(H,22,26) |
| InChIKey | JIPKFQFVERZWST-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|