C18H15N5O3S — CID 153385966
N-(4-amino-3,4-dioxo-1-pyridin-3-ylbutan-2-yl)-5-pyridin-2-yl-1,2-thiazole-4-carboxamide (PubChem CID 153385966) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-pyridin-3-ylbutan-2-yl)-5-pyridin-2-yl-1,2-thiazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-pyridin-3-ylbutan-2-yl)-5-pyridin-2-yl-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 153385966 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-pyridin-3-ylbutan-2-yl)-5-pyridin-2-yl-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1cccnc1)NC(=O)c1cnsc1-c1ccccn1 |
| InChI | InChI=1S/C18H15N5O3S/c19-17(25)15(24)14(8-11-4-3-6-20-9-11)23-18(26)12-10-22-27-16(12)13-5-1-2-7-21-13/h1-7,9-10,14H,8H2,(H2,19,25)(H,23,26) |
| InChIKey | QDFDMLXYYWGKBX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|