C18H16N6O3 — CID 153385349
N-(4-amino-3,4-dioxo-1-pyridin-3-ylbutan-2-yl)-2-pyridin-4-ylpyrazole-3-carboxamide (PubChem CID 153385349) has the molecular formula C18H16N6O3 and a molecular weight of 364.37 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-pyridin-3-ylbutan-2-yl)-2-pyridin-4-ylpyrazole-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-pyridin-3-ylbutan-2-yl)-2-pyridin-4-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 153385349 |
| Molecular Formula | C18H16N6O3 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-pyridin-3-ylbutan-2-yl)-2-pyridin-4-ylpyrazole-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1cccnc1)NC(=O)c1ccnn1-c1ccncc1 |
| InChI | InChI=1S/C18H16N6O3/c19-17(26)16(25)14(10-12-2-1-6-21-11-12)23-18(27)15-5-9-22-24(15)13-3-7-20-8-4-13/h1-9,11,14H,10H2,(H2,19,26)(H,23,27) |
| InChIKey | CVMHADKFNXVGES-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|