C20H17ClN4O3 — CID 142753520
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-chloro-1-phenylpyrazole-5-carboxamide (PubChem CID 142753520) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-chloro-1-phenylpyrazole-5-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-chloro-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 142753520 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-chloro-1-phenylpyrazole-5-carboxamide |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)c1cc(Cl)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H17ClN4O3/c21-17-12-16(25(24-17)14-9-5-2-6-10-14)20(28)23-15(18(26)19(22)27)11-13-7-3-1-4-8-13/h1-10,12,15H,11H2,(H2,22,27)(H,23,28)/t15-/m0/s1 |
| InChIKey | MUTRRMABBGUFLY-HNNXBMFYSA-N |
| XLogP | 1.92 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|