C29H29N5O3 — CID 134397170
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[4-[(benzylamino)methyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 134397170) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[4-[(benzylamino)methyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[4-[(benzylamino)methyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 134397170 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[4-[(benzylamino)methyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)n(-c2ccc(CNCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C29H29N5O3/c1-20-16-26(29(37)32-25(27(35)28(30)36)17-21-8-4-2-5-9-21)34(33-20)24-14-12-23(13-15-24)19-31-18-22-10-6-3-7-11-22/h2-16,25,31H,17-19H2,1H3,(H2,30,36)(H,32,37) |
| InChIKey | JUQNAPINTHPHQE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|