C28H27N5O5S — CID 134397178
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[4-(benzenesulfonamidomethyl)phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 134397178) has the molecular formula C28H27N5O5S and a molecular weight of 545.62 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[4-(benzenesulfonamidomethyl)phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[4-(benzenesulfonamidomethyl)phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 134397178 |
| Molecular Formula | C28H27N5O5S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[4-(benzenesulfonamidomethyl)phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)n(-c2ccc(CNS(=O)(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C28H27N5O5S/c1-19-16-25(28(36)31-24(26(34)27(29)35)17-20-8-4-2-5-9-20)33(32-19)22-14-12-21(13-15-22)18-30-39(37,38)23-10-6-3-7-11-23/h2-16,24,30H,17-18H2,1H3,(H2,29,35)(H,31,36) |
| InChIKey | ALVFPMXDYMDTBG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 153.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|