C24H25N5O5 — CID 142753803
methyl N-[[4-[5-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]carbamoyl]-3-methylpyrazol-1-yl]phenyl]methyl]carbamate (PubChem CID 142753803) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is methyl N-[[4-[5-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]carbamoyl]-3-methylpyrazol-1-yl]phenyl]methyl]carbamate.
| Compound Name | methyl N-[[4-[5-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]carbamoyl]-3-methylpyrazol-1-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142753803 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | methyl N-[[4-[5-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]carbamoyl]-3-methylpyrazol-1-yl]phenyl]methyl]carbamate |
| SMILES | COC(=O)NCc1ccc(-n2nc(C)cc2C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)cc1 |
| InChI | InChI=1S/C24H25N5O5/c1-15-12-20(29(28-15)18-10-8-17(9-11-18)14-26-24(33)34-2)23(32)27-19(21(30)22(25)31)13-16-6-4-3-5-7-16/h3-12,19H,13-14H2,1-2H3,(H2,25,31)(H,26,33)(H,27,32)/t19-/m0/s1 |
| InChIKey | ALZFNCSZPVQVHD-IBGZPJMESA-N |
| XLogP | 1.43 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|