C29H27N5O4 — CID 142753710
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-[3-(benzamidomethyl)phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 142753710) has the molecular formula C29H27N5O4 and a molecular weight of 509.57 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-[3-(benzamidomethyl)phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-[3-(benzamidomethyl)phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142753710 |
| Molecular Formula | C29H27N5O4 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-[3-(benzamidomethyl)phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)n(-c2cccc(CNC(=O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C29H27N5O4/c1-19-15-25(29(38)32-24(26(35)27(30)36)17-20-9-4-2-5-10-20)34(33-19)23-14-8-11-21(16-23)18-31-28(37)22-12-6-3-7-13-22/h2-16,24H,17-18H2,1H3,(H2,30,36)(H,31,37)(H,32,38)/t24-/m0/s1 |
| InChIKey | MFRWESBAIAOFSU-DEOSSOPVSA-N |
| XLogP | 2.51 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|