C24H25N5O4 — CID 134397013
2-[3-(acetamidomethyl)phenyl]-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-methylpyrazole-3-carboxamide (PubChem CID 134397013) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-[3-(acetamidomethyl)phenyl]-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-[3-(acetamidomethyl)phenyl]-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 134397013 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-[3-(acetamidomethyl)phenyl]-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-methylpyrazole-3-carboxamide |
| SMILES | CC(=O)NCc1cccc(-n2nc(C)cc2C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)c1 |
| InChI | InChI=1S/C24H25N5O4/c1-15-11-21(29(28-15)19-10-6-9-18(12-19)14-26-16(2)30)24(33)27-20(22(31)23(25)32)13-17-7-4-3-5-8-17/h3-12,20H,13-14H2,1-2H3,(H2,25,32)(H,26,30)(H,27,33) |
| InChIKey | IBKRZGHXRVEGDH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|