C29H28N4O4 — CID 142753807
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-[4-(phenylmethoxymethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 142753807) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-[4-(phenylmethoxymethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-[4-(phenylmethoxymethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142753807 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-[4-(phenylmethoxymethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)n(-c2ccc(COCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C29H28N4O4/c1-20-16-26(29(36)31-25(27(34)28(30)35)17-21-8-4-2-5-9-21)33(32-20)24-14-12-23(13-15-24)19-37-18-22-10-6-3-7-11-22/h2-16,25H,17-19H2,1H3,(H2,30,35)(H,31,36)/t25-/m0/s1 |
| InChIKey | UDNJNAJJVKZEPE-VWLOTQADSA-N |
| XLogP | 3.29 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|