C21H21N5O3 — CID 142753634
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(6-methyl-2-pyridinyl)pyrazole-3-carboxamide (PubChem CID 142753634) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(6-methyl-2-pyridinyl)pyrazole-3-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(6-methyl-2-pyridinyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142753634 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(6-methyl-2-pyridinyl)pyrazole-3-carboxamide |
| SMILES | Cc1cccc(-n2nc(C)cc2C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)n1 |
| InChI | InChI=1S/C21H21N5O3/c1-13-7-6-10-18(23-13)26-17(11-14(2)25-26)21(29)24-16(19(27)20(22)28)12-15-8-4-3-5-9-15/h3-11,16H,12H2,1-2H3,(H2,22,28)(H,24,29)/t16-/m0/s1 |
| InChIKey | KUQYWTMJMKUVNG-INIZCTEOSA-N |
| XLogP | 1.28 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|