C24H21N5O3S — CID 142753808
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazole-3-carboxamide (PubChem CID 142753808) has the molecular formula C24H21N5O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazole-3-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142753808 |
| Molecular Formula | C24H21N5O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)n(-c2nc(-c3ccccc3)cs2)n1 |
| InChI | InChI=1S/C24H21N5O3S/c1-15-12-20(29(28-15)24-27-19(14-33-24)17-10-6-3-7-11-17)23(32)26-18(21(30)22(25)31)13-16-8-4-2-5-9-16/h2-12,14,18H,13H2,1H3,(H2,25,31)(H,26,32)/t18-/m0/s1 |
| InChIKey | RBEROYNYIWCXNS-SFHVURJKSA-N |
| XLogP | 2.70 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|