C23H21N5O3S — CID 142753623
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(4-methyl-1,3-benzothiazol-2-yl)pyrazole-3-carboxamide (PubChem CID 142753623) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(4-methyl-1,3-benzothiazol-2-yl)pyrazole-3-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(4-methyl-1,3-benzothiazol-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142753623 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-5-methyl-2-(4-methyl-1,3-benzothiazol-2-yl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)n(-c2nc3c(C)cccc3s2)n1 |
| InChI | InChI=1S/C23H21N5O3S/c1-13-7-6-10-18-19(13)26-23(32-18)28-17(11-14(2)27-28)22(31)25-16(20(29)21(24)30)12-15-8-4-3-5-9-15/h3-11,16H,12H2,1-2H3,(H2,24,30)(H,25,31)/t16-/m0/s1 |
| InChIKey | IETKCQLJINYWEE-INIZCTEOSA-N |
| XLogP | 2.49 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|