C21H21N5O4 — CID 142753586
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-(6-methoxy-2-pyridinyl)-5-methylpyrazole-3-carboxamide (PubChem CID 142753586) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-(6-methoxy-2-pyridinyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-(6-methoxy-2-pyridinyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142753586 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-(6-methoxy-2-pyridinyl)-5-methylpyrazole-3-carboxamide |
| SMILES | COc1cccc(-n2nc(C)cc2C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)n1 |
| InChI | InChI=1S/C21H21N5O4/c1-13-11-16(26(25-13)17-9-6-10-18(24-17)30-2)21(29)23-15(19(27)20(22)28)12-14-7-4-3-5-8-14/h3-11,15H,12H2,1-2H3,(H2,22,28)(H,23,29)/t15-/m0/s1 |
| InChIKey | RMCHPODCOUKVCY-HNNXBMFYSA-N |
| XLogP | 0.98 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|