C20H18N4O4 — CID 153386087
3-[(5-methyl-2-pyridin-2-ylpyrazole-3-carbonyl)amino]-2-oxo-4-phenylbutanoic acid (PubChem CID 153386087) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is 3-[(5-methyl-2-pyridin-2-ylpyrazole-3-carbonyl)amino]-2-oxo-4-phenylbutanoic acid.
| Compound Name | 3-[(5-methyl-2-pyridin-2-ylpyrazole-3-carbonyl)amino]-2-oxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 153386087 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-[(5-methyl-2-pyridin-2-ylpyrazole-3-carbonyl)amino]-2-oxo-4-phenylbutanoic acid |
| SMILES | Cc1cc(C(=O)NC(Cc2ccccc2)C(=O)C(=O)O)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C20H18N4O4/c1-13-11-16(24(23-13)17-9-5-6-10-21-17)19(26)22-15(18(25)20(27)28)12-14-7-3-2-4-8-14/h2-11,15H,12H2,1H3,(H,22,26)(H,27,28) |
| InChIKey | SXACQQHKYUOHLN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|