C30H29N5O5 — CID 142753670
benzyl N-[[4-[5-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]carbamoyl]-3-methylpyrazol-1-yl]phenyl]methyl]carbamate (PubChem CID 142753670) has the molecular formula C30H29N5O5 and a molecular weight of 539.59 g/mol. Its IUPAC name is benzyl N-[[4-[5-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]carbamoyl]-3-methylpyrazol-1-yl]phenyl]methyl]carbamate.
| Compound Name | benzyl N-[[4-[5-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]carbamoyl]-3-methylpyrazol-1-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142753670 |
| Molecular Formula | C30H29N5O5 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | benzyl N-[[4-[5-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]carbamoyl]-3-methylpyrazol-1-yl]phenyl]methyl]carbamate |
| SMILES | Cc1cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)n(-c2ccc(CNC(=O)OCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C30H29N5O5/c1-20-16-26(29(38)33-25(27(36)28(31)37)17-21-8-4-2-5-9-21)35(34-20)24-14-12-22(13-15-24)18-32-30(39)40-19-23-10-6-3-7-11-23/h2-16,25H,17-19H2,1H3,(H2,31,37)(H,32,39)(H,33,38)/t25-/m0/s1 |
| InChIKey | YPOATAQDPRAELW-VWLOTQADSA-N |
| XLogP | 3.00 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|