C16H14N6O4 — CID 149453599
N-[4-amino-1-(furan-2-yl)-3,4-dioxobutan-2-yl]-2-pyrimidin-2-ylpyrazole-3-carboxamide (PubChem CID 149453599) has the molecular formula C16H14N6O4 and a molecular weight of 354.33 g/mol. Its IUPAC name is N-[4-amino-1-(furan-2-yl)-3,4-dioxobutan-2-yl]-2-pyrimidin-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[4-amino-1-(furan-2-yl)-3,4-dioxobutan-2-yl]-2-pyrimidin-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 149453599 |
| Molecular Formula | C16H14N6O4 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[4-amino-1-(furan-2-yl)-3,4-dioxobutan-2-yl]-2-pyrimidin-2-ylpyrazole-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccco1)NC(=O)c1ccnn1-c1ncccn1 |
| InChI | InChI=1S/C16H14N6O4/c17-14(24)13(23)11(9-10-3-1-8-26-10)21-15(25)12-4-7-20-22(12)16-18-5-2-6-19-16/h1-8,11H,9H2,(H2,17,24)(H,21,25) |
| InChIKey | YYCMRQNRZJDRST-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 146.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|