C19H16N6O4 — CID 153386037
N-[4-amino-1-(4H-furo[3,2-b]pyrrol-3-yl)-3,4-dioxobutan-2-yl]-2-pyridin-2-ylpyrazole-3-carboxamide (PubChem CID 153386037) has the molecular formula C19H16N6O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is N-[4-amino-1-(4H-furo[3,2-b]pyrrol-3-yl)-3,4-dioxobutan-2-yl]-2-pyridin-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[4-amino-1-(4H-furo[3,2-b]pyrrol-3-yl)-3,4-dioxobutan-2-yl]-2-pyridin-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 153386037 |
| Molecular Formula | C19H16N6O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[4-amino-1-(4H-furo[3,2-b]pyrrol-3-yl)-3,4-dioxobutan-2-yl]-2-pyridin-2-ylpyrazole-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1coc2cc[nH]c12)NC(=O)c1ccnn1-c1ccccn1 |
| InChI | InChI=1S/C19H16N6O4/c20-18(27)17(26)12(9-11-10-29-14-5-7-22-16(11)14)24-19(28)13-4-8-23-25(13)15-3-1-2-6-21-15/h1-8,10,12,22H,9H2,(H2,20,27)(H,24,28) |
| InChIKey | UQAIMSIYVFTHRK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|