C19H15N5O4S — CID 153484099
N-(4-amino-3,4-dioxo-1-thieno[3,4-b]furan-3-ylbutan-2-yl)-3-pyridin-2-ylimidazole-4-carboxamide (PubChem CID 153484099) has the molecular formula C19H15N5O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-thieno[3,4-b]furan-3-ylbutan-2-yl)-3-pyridin-2-ylimidazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-thieno[3,4-b]furan-3-ylbutan-2-yl)-3-pyridin-2-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 153484099 |
| Molecular Formula | C19H15N5O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-thieno[3,4-b]furan-3-ylbutan-2-yl)-3-pyridin-2-ylimidazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1coc2cscc12)NC(=O)c1cncn1-c1ccccn1 |
| InChI | InChI=1S/C19H15N5O4S/c20-18(26)17(25)13(5-11-7-28-15-9-29-8-12(11)15)23-19(27)14-6-21-10-24(14)16-3-1-2-4-22-16/h1-4,6-10,13H,5H2,(H2,20,26)(H,23,27) |
| InChIKey | ATPQGIIHHGOVGX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|