C21H18N6O4 — CID 153385659
N-(4-amino-1-furo[2,3-b]pyridin-3-yl-3,4-dioxobutan-2-yl)-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide (PubChem CID 153385659) has the molecular formula C21H18N6O4 and a molecular weight of 418.41 g/mol. Its IUPAC name is N-(4-amino-1-furo[2,3-b]pyridin-3-yl-3,4-dioxobutan-2-yl)-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide.
| Compound Name | N-(4-amino-1-furo[2,3-b]pyridin-3-yl-3,4-dioxobutan-2-yl)-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 153385659 |
| Molecular Formula | C21H18N6O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-(4-amino-1-furo[2,3-b]pyridin-3-yl-3,4-dioxobutan-2-yl)-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide |
| SMILES | Cc1ncc(C(=O)NC(Cc2coc3ncccc23)C(=O)C(N)=O)n1-c1ccccn1 |
| InChI | InChI=1S/C21H18N6O4/c1-12-25-10-16(27(12)17-6-2-3-7-23-17)20(30)26-15(18(28)19(22)29)9-13-11-31-21-14(13)5-4-8-24-21/h2-8,10-11,15H,9H2,1H3,(H2,22,29)(H,26,30) |
| InChIKey | OQBOPALZLOJMJP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 146.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|