C19H19N5O4 — CID 153385833
N-[1-amino-5-(furan-3-yl)-1,2-dioxopentan-3-yl]-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide (PubChem CID 153385833) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[1-amino-5-(furan-3-yl)-1,2-dioxopentan-3-yl]-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide.
| Compound Name | N-[1-amino-5-(furan-3-yl)-1,2-dioxopentan-3-yl]-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 153385833 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-[1-amino-5-(furan-3-yl)-1,2-dioxopentan-3-yl]-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide |
| SMILES | Cc1ncc(C(=O)NC(CCc2ccoc2)C(=O)C(N)=O)n1-c1ccccn1 |
| InChI | InChI=1S/C19H19N5O4/c1-12-22-10-15(24(12)16-4-2-3-8-21-16)19(27)23-14(17(25)18(20)26)6-5-13-7-9-28-11-13/h2-4,7-11,14H,5-6H2,1H3,(H2,20,26)(H,23,27) |
| InChIKey | GIBWCPBPTYXCQF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|