C23H20N4O4 — CID 153385382
N-[4-amino-1-(1-benzofuran-3-yl)-3,4-dioxobutan-2-yl]-2-methyl-3-phenylimidazole-4-carboxamide (PubChem CID 153385382) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is N-[4-amino-1-(1-benzofuran-3-yl)-3,4-dioxobutan-2-yl]-2-methyl-3-phenylimidazole-4-carboxamide.
| Compound Name | N-[4-amino-1-(1-benzofuran-3-yl)-3,4-dioxobutan-2-yl]-2-methyl-3-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 153385382 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[4-amino-1-(1-benzofuran-3-yl)-3,4-dioxobutan-2-yl]-2-methyl-3-phenylimidazole-4-carboxamide |
| SMILES | Cc1ncc(C(=O)NC(Cc2coc3ccccc23)C(=O)C(N)=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20N4O4/c1-14-25-12-19(27(14)16-7-3-2-4-8-16)23(30)26-18(21(28)22(24)29)11-15-13-31-20-10-6-5-9-17(15)20/h2-10,12-13,18H,11H2,1H3,(H2,24,29)(H,26,30) |
| InChIKey | JWZMYTSFFKEFPE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|