C22H19N5O3S — CID 153385785
N-[4-amino-1-(1-benzothiophen-3-yl)-3,4-dioxobutan-2-yl]-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide (PubChem CID 153385785) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[4-amino-1-(1-benzothiophen-3-yl)-3,4-dioxobutan-2-yl]-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide.
| Compound Name | N-[4-amino-1-(1-benzothiophen-3-yl)-3,4-dioxobutan-2-yl]-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 153385785 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[4-amino-1-(1-benzothiophen-3-yl)-3,4-dioxobutan-2-yl]-2-methyl-3-pyridin-2-ylimidazole-4-carboxamide |
| SMILES | Cc1ncc(C(=O)NC(Cc2csc3ccccc23)C(=O)C(N)=O)n1-c1ccccn1 |
| InChI | InChI=1S/C22H19N5O3S/c1-13-25-11-17(27(13)19-8-4-5-9-24-19)22(30)26-16(20(28)21(23)29)10-14-12-31-18-7-3-2-6-15(14)18/h2-9,11-12,16H,10H2,1H3,(H2,23,29)(H,26,30) |
| InChIKey | FLACPGHOUNHRKR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|