C21H16N4O4S — CID 153385466
N-[4-amino-1-(1-benzothiophen-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,3-oxazole-5-carboxamide (PubChem CID 153385466) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is N-[4-amino-1-(1-benzothiophen-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[4-amino-1-(1-benzothiophen-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 153385466 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[4-amino-1-(1-benzothiophen-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,3-oxazole-5-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1csc2ccccc12)NC(=O)c1ocnc1-c1ccccn1 |
| InChI | InChI=1S/C21H16N4O4S/c22-20(27)18(26)15(9-12-10-30-16-7-2-1-5-13(12)16)25-21(28)19-17(24-11-29-19)14-6-3-4-8-23-14/h1-8,10-11,15H,9H2,(H2,22,27)(H,25,28) |
| InChIKey | HQQOHYHCAYWCAB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|