C17H15N5O3S — CID 153483969
N-[4-amino-3,4-dioxo-1-(1H-pyrrol-2-yl)butan-2-yl]-4-pyridin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 153483969) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is N-[4-amino-3,4-dioxo-1-(1H-pyrrol-2-yl)butan-2-yl]-4-pyridin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-amino-3,4-dioxo-1-(1H-pyrrol-2-yl)butan-2-yl]-4-pyridin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 153483969 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[4-amino-3,4-dioxo-1-(1H-pyrrol-2-yl)butan-2-yl]-4-pyridin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccc[nH]1)NC(=O)c1scnc1-c1ccccn1 |
| InChI | InChI=1S/C17H15N5O3S/c18-16(24)14(23)12(8-10-4-3-7-19-10)22-17(25)15-13(21-9-26-15)11-5-1-2-6-20-11/h1-7,9,12,19H,8H2,(H2,18,24)(H,22,25) |
| InChIKey | KSQHFSXYIDIQNA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|