C15H12N6O3S2 — CID 147165549
N-[4-amino-3,4-dioxo-1-(1,3-thiazol-5-yl)butan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 147165549) has the molecular formula C15H12N6O3S2 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[4-amino-3,4-dioxo-1-(1,3-thiazol-5-yl)butan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[4-amino-3,4-dioxo-1-(1,3-thiazol-5-yl)butan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 147165549 |
| Molecular Formula | C15H12N6O3S2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | N-[4-amino-3,4-dioxo-1-(1,3-thiazol-5-yl)butan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1cncs1)NC(=O)c1nsnc1-c1ccccn1 |
| InChI | InChI=1S/C15H12N6O3S2/c16-14(23)13(22)10(5-8-6-17-7-25-8)19-15(24)12-11(20-26-21-12)9-3-1-2-4-18-9/h1-4,6-7,10H,5H2,(H2,16,23)(H,19,24) |
| InChIKey | BWRSXMOMMFAOMZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 140.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|