C18H15N7O3S — CID 153385867
N-[4-amino-1-(1,4-dihydropyrrolo[3,2-b]pyrrol-6-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 153385867) has the molecular formula C18H15N7O3S and a molecular weight of 409.43 g/mol. Its IUPAC name is N-[4-amino-1-(1,4-dihydropyrrolo[3,2-b]pyrrol-6-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[4-amino-1-(1,4-dihydropyrrolo[3,2-b]pyrrol-6-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 153385867 |
| Molecular Formula | C18H15N7O3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[4-amino-1-(1,4-dihydropyrrolo[3,2-b]pyrrol-6-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1c[nH]c2cc[nH]c12)NC(=O)c1nsnc1-c1ccccn1 |
| InChI | InChI=1S/C18H15N7O3S/c19-17(27)16(26)12(7-9-8-22-11-4-6-21-13(9)11)23-18(28)15-14(24-29-25-15)10-3-1-2-5-20-10/h1-6,8,12,21-22H,7H2,(H2,19,27)(H,23,28) |
| InChIKey | YSKOZSDSJRWECH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|