C22H19N5O3S — CID 153386267
N-[4-amino-1-(1H-indol-3-yl)-3,4-dioxobutan-2-yl]-3-methyl-4-pyridin-2-yl-1,2-thiazole-5-carboxamide (PubChem CID 153386267) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[4-amino-1-(1H-indol-3-yl)-3,4-dioxobutan-2-yl]-3-methyl-4-pyridin-2-yl-1,2-thiazole-5-carboxamide.
| Compound Name | N-[4-amino-1-(1H-indol-3-yl)-3,4-dioxobutan-2-yl]-3-methyl-4-pyridin-2-yl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 153386267 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[4-amino-1-(1H-indol-3-yl)-3,4-dioxobutan-2-yl]-3-methyl-4-pyridin-2-yl-1,2-thiazole-5-carboxamide |
| SMILES | Cc1nsc(C(=O)NC(Cc2c[nH]c3ccccc23)C(=O)C(N)=O)c1-c1ccccn1 |
| InChI | InChI=1S/C22H19N5O3S/c1-12-18(16-8-4-5-9-24-16)20(31-27-12)22(30)26-17(19(28)21(23)29)10-13-11-25-15-7-3-2-6-14(13)15/h2-9,11,17,25H,10H2,1H3,(H2,23,29)(H,26,30) |
| InChIKey | RYEHRGGJOMETKX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|