C19H19N5O3 — CID 153386322
N-[4-amino-3,4-dioxo-1-(1H-pyrrol-3-yl)butan-2-yl]-5-methyl-4-pyridin-2-yl-1H-pyrrole-3-carboxamide (PubChem CID 153386322) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[4-amino-3,4-dioxo-1-(1H-pyrrol-3-yl)butan-2-yl]-5-methyl-4-pyridin-2-yl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[4-amino-3,4-dioxo-1-(1H-pyrrol-3-yl)butan-2-yl]-5-methyl-4-pyridin-2-yl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 153386322 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[4-amino-3,4-dioxo-1-(1H-pyrrol-3-yl)butan-2-yl]-5-methyl-4-pyridin-2-yl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]cc(C(=O)NC(Cc2cc[nH]c2)C(=O)C(N)=O)c1-c1ccccn1 |
| InChI | InChI=1S/C19H19N5O3/c1-11-16(14-4-2-3-6-22-14)13(10-23-11)19(27)24-15(17(25)18(20)26)8-12-5-7-21-9-12/h2-7,9-10,15,21,23H,8H2,1H3,(H2,20,26)(H,24,27) |
| InChIKey | OOJKEPGEVKGOGZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|