C17H16N6O3 — CID 153385762
N-[4-amino-3,4-dioxo-1-(1H-pyrrol-3-yl)butan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide (PubChem CID 153385762) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-[4-amino-3,4-dioxo-1-(1H-pyrrol-3-yl)butan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide.
| Compound Name | N-[4-amino-3,4-dioxo-1-(1H-pyrrol-3-yl)butan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 153385762 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[4-amino-3,4-dioxo-1-(1H-pyrrol-3-yl)butan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1cc[nH]c1)NC(=O)c1cncn1-c1ccccn1 |
| InChI | InChI=1S/C17H16N6O3/c18-16(25)15(24)12(7-11-4-6-19-8-11)22-17(26)13-9-20-10-23(13)14-3-1-2-5-21-14/h1-6,8-10,12,19H,7H2,(H2,18,25)(H,22,26) |
| InChIKey | GJJCAHVNFLBIBT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|