C16H14N6O3S — CID 153386313
N-[4-amino-3,4-dioxo-1-(1,2-thiazol-5-yl)butan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide (PubChem CID 153386313) has the molecular formula C16H14N6O3S and a molecular weight of 370.39 g/mol. Its IUPAC name is N-[4-amino-3,4-dioxo-1-(1,2-thiazol-5-yl)butan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide.
| Compound Name | N-[4-amino-3,4-dioxo-1-(1,2-thiazol-5-yl)butan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 153386313 |
| Molecular Formula | C16H14N6O3S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[4-amino-3,4-dioxo-1-(1,2-thiazol-5-yl)butan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccns1)NC(=O)c1cncn1-c1ccccn1 |
| InChI | InChI=1S/C16H14N6O3S/c17-15(24)14(23)11(7-10-4-6-20-26-10)21-16(25)12-8-18-9-22(12)13-3-1-2-5-19-13/h1-6,8-9,11H,7H2,(H2,17,24)(H,21,25) |
| InChIKey | ZJPTXKPOOBZWMD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|