C22H21N5O3 — CID 134396793
N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide (PubChem CID 134396793) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide.
| Compound Name | N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 134396793 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-3-pyridin-2-ylimidazole-4-carboxamide |
| SMILES | O=C(NC1CC1)C(=O)C(Cc1ccccc1)NC(=O)c1cncn1-c1ccccn1 |
| InChI | InChI=1S/C22H21N5O3/c28-20(22(30)25-16-9-10-16)17(12-15-6-2-1-3-7-15)26-21(29)18-13-23-14-27(18)19-8-4-5-11-24-19/h1-8,11,13-14,16-17H,9-10,12H2,(H,25,30)(H,26,29) |
| InChIKey | PRNOZEWEYXPOPW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|