C27H24N6O3 — CID 67241048
N-[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-pyridin-2-ylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 67241048) has the molecular formula C27H24N6O3 and a molecular weight of 480.53 g/mol. Its IUPAC name is N-[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-pyridin-2-ylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-pyridin-2-ylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67241048 |
| Molecular Formula | C27H24N6O3 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | N-[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-pyridin-2-ylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CC1)C(=O)[C@H](Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C27H24N6O3/c34-24(27(36)30-19-11-12-19)23(17-18-7-2-1-3-8-18)31-26(35)20-9-6-15-29-25(20)33-16-13-22(32-33)21-10-4-5-14-28-21/h1-10,13-16,19,23H,11-12,17H2,(H,30,36)(H,31,35)/t23-/m0/s1 |
| InChIKey | RPZYFDAERQZCHS-QHCPKHFHSA-N |
| XLogP | 2.52 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|